C14H16FNO3S — CID 115987014
(E)-3-[2-fluoro-4-[methyl(2-methylsulfanylethyl)carbamoyl]phenyl]prop-2-enoic acid (PubChem CID 115987014) has the molecular formula C14H16FNO3S and a molecular weight of 297.35 g/mol. Its IUPAC name is (E)-3-[2-fluoro-4-[methyl(2-methylsulfanylethyl)carbamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-fluoro-4-[methyl(2-methylsulfanylethyl)carbamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115987014 |
| Molecular Formula | C14H16FNO3S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (E)-3-[2-fluoro-4-[methyl(2-methylsulfanylethyl)carbamoyl]phenyl]prop-2-enoic acid |
| SMILES | CSCCN(C)C(=O)c1ccc(/C=C/C(=O)O)c(F)c1 |
| InChI | InChI=1S/C14H16FNO3S/c1-16(7-8-20-2)14(19)11-4-3-10(12(15)9-11)5-6-13(17)18/h3-6,9H,7-8H2,1-2H3,(H,17,18)/b6-5+ |
| InChIKey | FBVGLLIIWBDKSS-AATRIKPKSA-N |
| XLogP | 2.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|