C20H20FNO3 — CID 113227314
(E)-3-[4-[benzyl(propan-2-yl)carbamoyl]-2-fluorophenyl]prop-2-enoic acid (PubChem CID 113227314) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is (E)-3-[4-[benzyl(propan-2-yl)carbamoyl]-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[benzyl(propan-2-yl)carbamoyl]-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 113227314 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (E)-3-[4-[benzyl(propan-2-yl)carbamoyl]-2-fluorophenyl]prop-2-enoic acid |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)c1ccc(/C=C/C(=O)O)c(F)c1 |
| InChI | InChI=1S/C20H20FNO3/c1-14(2)22(13-15-6-4-3-5-7-15)20(25)17-9-8-16(18(21)12-17)10-11-19(23)24/h3-12,14H,13H2,1-2H3,(H,23,24)/b11-10+ |
| InChIKey | LAHBHNBVMAXTMG-ZHACJKMWSA-N |
| XLogP | 3.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|