C19H23NO2 — CID 46989736
4-(hydroxymethyl)-N-[(3-methylphenyl)methyl]-N-propan-2-ylbenzamide (PubChem CID 46989736) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-(hydroxymethyl)-N-[(3-methylphenyl)methyl]-N-propan-2-ylbenzamide.
| Compound Name | 4-(hydroxymethyl)-N-[(3-methylphenyl)methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 46989736 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-(hydroxymethyl)-N-[(3-methylphenyl)methyl]-N-propan-2-ylbenzamide |
| SMILES | Cc1cccc(CN(C(=O)c2ccc(CO)cc2)C(C)C)c1 |
| InChI | InChI=1S/C19H23NO2/c1-14(2)20(12-17-6-4-5-15(3)11-17)19(22)18-9-7-16(13-21)8-10-18/h4-11,14,21H,12-13H2,1-3H3 |
| InChIKey | ASHALVGGAQCGMA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |