C18H19NO3 — CID 2813483
N-benzyl-N-propan-2-yl-1,3-benzodioxole-5-carboxamide (PubChem CID 2813483) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is N-benzyl-N-propan-2-yl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-benzyl-N-propan-2-yl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 2813483 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-benzyl-N-propan-2-yl-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19NO3/c1-13(2)19(11-14-6-4-3-5-7-14)18(20)15-8-9-16-17(10-15)22-12-21-16/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | GTQHUTNBFUACLV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |