C18H18O3 — CID 150018494
1-(1,3-benzodioxol-5-yl)-3-methyl-4-phenylbutan-1-one (PubChem CID 150018494) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-methyl-4-phenylbutan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-methyl-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 150018494 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-methyl-4-phenylbutan-1-one |
| SMILES | CC(CC(=O)c1ccc2c(c1)OCO2)Cc1ccccc1 |
| InChI | InChI=1S/C18H18O3/c1-13(9-14-5-3-2-4-6-14)10-16(19)15-7-8-17-18(11-15)21-12-20-17/h2-8,11,13H,9-10,12H2,1H3 |
| InChIKey | DETQLJQBSOVZAV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |