C20H20O5 — CID 14583727
1,4-bis(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-1-one (PubChem CID 14583727) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1,4-bis(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-1-one.
| Compound Name | 1,4-bis(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 14583727 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1,4-bis(1,3-benzodioxol-5-yl)-2,3-dimethylbutan-1-one |
| SMILES | CC(Cc1ccc2c(c1)OCO2)C(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20O5/c1-12(7-14-3-5-16-18(8-14)24-10-22-16)13(2)20(21)15-4-6-17-19(9-15)25-11-23-17/h3-6,8-9,12-13H,7,10-11H2,1-2H3 |
| InChIKey | CQXBMXDDWLNDQB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |