C14H16O4 — CID 132529759
(2R,3R)-1-(1,3-benzodioxol-5-yl)-2,3-dimethylpentane-1,4-dione (PubChem CID 132529759) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is (2R,3R)-1-(1,3-benzodioxol-5-yl)-2,3-dimethylpentane-1,4-dione.
| Compound Name | (2R,3R)-1-(1,3-benzodioxol-5-yl)-2,3-dimethylpentane-1,4-dione |
|---|---|
| PubChem CID | 132529759 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (2R,3R)-1-(1,3-benzodioxol-5-yl)-2,3-dimethylpentane-1,4-dione |
| SMILES | CC(=O)[C@H](C)[C@@H](C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H16O4/c1-8(10(3)15)9(2)14(16)11-4-5-12-13(6-11)18-7-17-12/h4-6,8-9H,7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | XLEWJDFMQHPVRO-RKDXNWHRSA-N |
| XLogP | 2.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |