C11H12O3 — CID 143061160
1-(1,3-benzodioxol-5-yl)ethanone;ethene (PubChem CID 143061160) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)ethanone;ethene.
| Compound Name | 1-(1,3-benzodioxol-5-yl)ethanone;ethene |
|---|---|
| PubChem CID | 143061160 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)ethanone;ethene |
| SMILES | C=C.CC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H8O3.C2H4/c1-6(10)7-2-3-8-9(4-7)12-5-11-8;1-2/h2-4H,5H2,1H3;1-2H2 |
| InChIKey | MVBDQRIXDRQETR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|