C16H15NO3 — CID 146006397
1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methanone (PubChem CID 146006397) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 146006397 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-(dimethylamino)phenyl]methanone |
| SMILES | CN(C)c1ccc(C(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C16H15NO3/c1-17(2)13-6-3-11(4-7-13)16(18)12-5-8-14-15(9-12)20-10-19-14/h3-9H,10H2,1-2H3 |
| InChIKey | NLCSRBYJXBNAIB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |