C18H15N3O3 — CID 134103507
2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-oxoethanimidoyl cyanide (PubChem CID 134103507) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-oxoethanimidoyl cyanide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 134103507 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[4-(dimethylamino)phenyl]-2-oxoethanimidoyl cyanide |
| SMILES | CN(C)c1ccc(/N=C(\C#N)C(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-21(2)14-6-4-13(5-7-14)20-15(10-19)18(22)12-3-8-16-17(9-12)24-11-23-16/h3-9H,11H2,1-2H3/b20-15+ |
| InChIKey | NMCDFLPGXMWMHH-HMMYKYKNSA-N |
| XLogP | 2.96 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|