C9H5ClO4 — CID 11052984
2-(1,3-benzodioxol-5-yl)-2-oxoacetyl chloride (PubChem CID 11052984) has the molecular formula C9H5ClO4 and a molecular weight of 212.59 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-2-oxoacetyl chloride.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-2-oxoacetyl chloride |
|---|---|
| PubChem CID | 11052984 |
| Molecular Formula | C9H5ClO4 |
| Molecular Weight | 212.59 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-2-oxoacetyl chloride |
| SMILES | O=C(Cl)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H5ClO4/c10-9(12)8(11)5-1-2-6-7(3-5)14-4-13-6/h1-3H,4H2 |
| InChIKey | IGGPPJXZNDJOTR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.59 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|