C13H9NO4S — CID 59213856
1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethane-1,2-dione (PubChem CID 59213856) has the molecular formula C13H9NO4S and a molecular weight of 275.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethane-1,2-dione.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 59213856 |
| Molecular Formula | C13H9NO4S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(4-methyl-1,3-thiazol-2-yl)ethane-1,2-dione |
| SMILES | Cc1csc(C(=O)C(=O)c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H9NO4S/c1-7-5-19-13(14-7)12(16)11(15)8-2-3-9-10(4-8)18-6-17-9/h2-5H,6H2,1H3 |
| InChIKey | GUWCFRGXLDXKPY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|