C14H7F3O3 — CID 43338555
1,3-benzodioxol-5-yl-(2,4,6-trifluorophenyl)methanone (PubChem CID 43338555) has the molecular formula C14H7F3O3 and a molecular weight of 280.20 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(2,4,6-trifluorophenyl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 43338555 |
| Molecular Formula | C14H7F3O3 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C14H7F3O3/c15-8-4-9(16)13(10(17)5-8)14(18)7-1-2-11-12(3-7)20-6-19-11/h1-5H,6H2 |
| InChIKey | UPQOXQQHQSWMJW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |