C15H11F2NO3 — CID 107123644
(3-amino-2,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone (PubChem CID 107123644) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
|---|---|
| PubChem CID | 107123644 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| SMILES | Nc1cc(F)cc(C(=O)c2ccc3c(c2)OCCO3)c1F |
| InChI | InChI=1S/C15H11F2NO3/c16-9-6-10(14(17)11(18)7-9)15(19)8-1-2-12-13(5-8)21-4-3-20-12/h1-2,5-7H,3-4,18H2 |
| InChIKey | RKMCRONCZPHWAM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|