C14H8F2O3 — CID 43337477
1,3-benzodioxol-5-yl-(2,5-difluorophenyl)methanone (PubChem CID 43337477) has the molecular formula C14H8F2O3 and a molecular weight of 262.21 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(2,5-difluorophenyl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 43337477 |
| Molecular Formula | C14H8F2O3 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(2,5-difluorophenyl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H8F2O3/c15-9-2-3-11(16)10(6-9)14(17)8-1-4-12-13(5-8)19-7-18-12/h1-6H,7H2 |
| InChIKey | KFISHXNNZQRAQV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |