C15H10F2O5 — CID 174580604
1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate (PubChem CID 174580604) has the molecular formula C15H10F2O5 and a molecular weight of 308.24 g/mol. Its IUPAC name is 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate.
| Compound Name | 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 174580604 |
| Molecular Formula | C15H10F2O5 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate |
| SMILES | Fc1ccc(F)cc1.O=COC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H6O5.C6H4F2/c10-4-12-9(11)6-1-2-7-8(3-6)14-5-13-7;7-5-1-2-6(8)4-3-5/h1-4H,5H2;1-4H |
| InChIKey | NICMAEZAIOBCJA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|