1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate

C15H10F2O5 — CID 174580604

IUPAC1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate
SMILESFc1ccc(F)cc1.O=COC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C9H6O5.C6H4F2/c10-4-12-9(11)6-1-2-7-8(3-6)14-5-13-7;7-5-1-2-6(8)4-3-5/h1-4H,5H2;1-4H
InChIKeyNICMAEZAIOBCJA-UHFFFAOYSA-N
MW308.24 g/mol
LogP2.69
Rot. Bonds2

About 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate

1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate (PubChem CID 174580604) has the molecular formula C15H10F2O5 and a molecular weight of 308.24 g/mol. Its IUPAC name is 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate.

Molecular Properties

Compound Name1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate
PubChem CID174580604
Molecular FormulaC15H10F2O5
Molecular Weight308.24 g/mol
Exact Mass308.05
IUPAC Name1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate
SMILESFc1ccc(F)cc1.O=COC(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C9H6O5.C6H4F2/c10-4-12-9(11)6-1-2-7-8(3-6)14-5-13-7;7-5-1-2-6(8)4-3-5/h1-4H,5H2;1-4H
InChIKeyNICMAEZAIOBCJA-UHFFFAOYSA-N
XLogP2.69
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.24
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate?
The IUPAC name of 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate (CID 174580604) is 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate.
What is the SMILES notation for 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate?
The canonical SMILES for 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate is Fc1ccc(F)cc1.O=COC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate?
The InChIKey is NICMAEZAIOBCJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O5.C6H4F2/c10-4-12-9(11)6-1-2-7-8(3-6)14-5-13-7;7-5-1-2-6(8)4-3-5/h1-4H,5H2;1-4H.
What are the key properties of 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate?
1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate has a molecular weight of 308.24 g/mol, XLogP of 2.69, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-difluorobenzene;formyl 1,3-benzodioxole-5-carboxylate is sourced from PubChem (CID 174580604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).