C13H7F3O — CID 43159843
(2,5-difluorophenyl)-(3-fluorophenyl)methanone (PubChem CID 43159843) has the molecular formula C13H7F3O and a molecular weight of 236.19 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(3-fluorophenyl)methanone.
| Compound Name | (2,5-difluorophenyl)-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 43159843 |
| Molecular Formula | C13H7F3O |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (2,5-difluorophenyl)-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H7F3O/c14-9-3-1-2-8(6-9)13(17)11-7-10(15)4-5-12(11)16/h1-7H |
| InChIKey | VSEATLLRFCUSJM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |