C13H4F6O — CID 112694154
(3-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone (PubChem CID 112694154) has the molecular formula C13H4F6O and a molecular weight of 290.16 g/mol. Its IUPAC name is (3-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone.
| Compound Name | (3-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone |
|---|---|
| PubChem CID | 112694154 |
| Molecular Formula | C13H4F6O |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | (3-fluorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H4F6O/c14-6-3-1-2-5(4-6)13(20)7-8(15)10(17)12(19)11(18)9(7)16/h1-4H |
| InChIKey | YEBHKFUZAYGKPQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|