C8H7FO3 — CID 55282672
1-(3-fluorophenyl)-2,2-dihydroxyethanone (PubChem CID 55282672) has the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2,2-dihydroxyethanone.
| Compound Name | 1-(3-fluorophenyl)-2,2-dihydroxyethanone |
|---|---|
| PubChem CID | 55282672 |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 1-(3-fluorophenyl)-2,2-dihydroxyethanone |
| SMILES | O=C(c1cccc(F)c1)C(O)O |
| InChI | InChI=1S/C8H7FO3/c9-6-3-1-2-5(4-6)7(10)8(11)12/h1-4,8,11-12H |
| InChIKey | ZMUZKTHKXHEDHL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|