About 3-fluoro-N'-sulfanylbenzohydrazide
3-fluoro-N'-sulfanylbenzohydrazide (PubChem CID 174650395) has the molecular formula C7H7FN2OS
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-fluoro-N'-sulfanylbenzohydrazide.
Molecular Properties
| Compound Name | 3-fluoro-N'-sulfanylbenzohydrazide |
| PubChem CID | 174650395 |
| Molecular Formula | C7H7FN2OS |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 3-fluoro-N'-sulfanylbenzohydrazide |
| SMILES | O=C(NNS)c1cccc(F)c1 |
| InChI | InChI=1S/C7H7FN2OS/c8-6-3-1-2-5(4-6)7(11)9-10-12/h1-4,10,12H,(H,9,11) |
| InChIKey | ZVDLEYYFABRIHA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N'-sulfanylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N'-sulfanylbenzohydrazide?
The IUPAC name of 3-fluoro-N'-sulfanylbenzohydrazide (CID 174650395) is 3-fluoro-N'-sulfanylbenzohydrazide.
What is the SMILES notation for 3-fluoro-N'-sulfanylbenzohydrazide?
The canonical SMILES for 3-fluoro-N'-sulfanylbenzohydrazide is O=C(NNS)c1cccc(F)c1.
What is the InChIKey of 3-fluoro-N'-sulfanylbenzohydrazide?
The InChIKey is ZVDLEYYFABRIHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2OS/c8-6-3-1-2-5(4-6)7(11)9-10-12/h1-4,10,12H,(H,9,11).
What are the key properties of 3-fluoro-N'-sulfanylbenzohydrazide?
3-fluoro-N'-sulfanylbenzohydrazide has a molecular weight of 186.21 g/mol, XLogP of 0.90, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N'-sulfanylbenzohydrazide is sourced from PubChem (CID 174650395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).