C11H14FNO — CID 116586938
1-(3-fluorophenyl)-2-methyl-3-(methylamino)propan-1-one (PubChem CID 116586938) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-methyl-3-(methylamino)propan-1-one.
| Compound Name | 1-(3-fluorophenyl)-2-methyl-3-(methylamino)propan-1-one |
|---|---|
| PubChem CID | 116586938 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-(3-fluorophenyl)-2-methyl-3-(methylamino)propan-1-one |
| SMILES | CNCC(C)C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C11H14FNO/c1-8(7-13-2)11(14)9-4-3-5-10(12)6-9/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | DGCQNLBWHOJBKM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |