C15H9F3O3 — CID 79757453
2,3-dihydro-1,4-benzodioxin-6-yl-(2,3,4-trifluorophenyl)methanone (PubChem CID 79757453) has the molecular formula C15H9F3O3 and a molecular weight of 294.23 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-(2,3,4-trifluorophenyl)methanone.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 79757453 |
| Molecular Formula | C15H9F3O3 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCCO2)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H9F3O3/c16-10-3-2-9(13(17)14(10)18)15(19)8-1-4-11-12(7-8)21-6-5-20-11/h1-4,7H,5-6H2 |
| InChIKey | DPHADXMBBQNIPP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|