C15H12BrNO3 — CID 116591847
(2-amino-4-bromophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone (PubChem CID 116591847) has the molecular formula C15H12BrNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is (2-amino-4-bromophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone.
| Compound Name | (2-amino-4-bromophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
|---|---|
| PubChem CID | 116591847 |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | (2-amino-4-bromophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| SMILES | Nc1cc(Br)ccc1C(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H12BrNO3/c16-10-2-3-11(12(17)8-10)15(18)9-1-4-13-14(7-9)20-6-5-19-13/h1-4,7-8H,5-6,17H2 |
| InChIKey | BIDVZPJWAWEPQP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|