C15H10Br2O2 — CID 107944745
(2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone (PubChem CID 107944745) has the molecular formula C15H10Br2O2 and a molecular weight of 382.05 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone.
| Compound Name | (2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone |
|---|---|
| PubChem CID | 107944745 |
| Molecular Formula | C15H10Br2O2 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | (2,4-dibromophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCO2)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H10Br2O2/c16-11-2-3-12(13(17)8-11)15(18)10-1-4-14-9(7-10)5-6-19-14/h1-4,7-8H,5-6H2 |
| InChIKey | AGWVIQDCIQTLLE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |