C15H9BrF2O2 — CID 106944382
(3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone (PubChem CID 106944382) has the molecular formula C15H9BrF2O2 and a molecular weight of 339.14 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone |
|---|---|
| PubChem CID | 106944382 |
| Molecular Formula | C15H9BrF2O2 |
| Molecular Weight | 339.14 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCO2)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H9BrF2O2/c16-10-2-3-11(17)13(14(10)18)15(19)9-1-4-12-8(7-9)5-6-20-12/h1-4,7H,5-6H2 |
| InChIKey | JNBXMIDCPBIWGX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.14 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|