C16H11F3O2 — CID 65101149
3,4-dihydro-2H-chromen-6-yl-(2,4,6-trifluorophenyl)methanone (PubChem CID 65101149) has the molecular formula C16H11F3O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl-(2,4,6-trifluorophenyl)methanone.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl-(2,4,6-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 65101149 |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl-(2,4,6-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCCO2)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C16H11F3O2/c17-11-7-12(18)15(13(19)8-11)16(20)10-3-4-14-9(6-10)2-1-5-21-14/h3-4,6-8H,1-2,5H2 |
| InChIKey | ISCSUZVELVNTEP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |