C15H11ClO3 — CID 21408356
1-(1,3-benzodioxol-5-yl)-2-chloro-2-phenylethanone (PubChem CID 21408356) has the molecular formula C15H11ClO3 and a molecular weight of 274.70 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-chloro-2-phenylethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-chloro-2-phenylethanone |
|---|---|
| PubChem CID | 21408356 |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-chloro-2-phenylethanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C15H11ClO3/c16-14(10-4-2-1-3-5-10)15(17)11-6-7-12-13(8-11)19-9-18-12/h1-8,14H,9H2 |
| InChIKey | JTIBPQBMZCYAAR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|