C12H13BrO3 — CID 71313695
1-(1,3-benzodioxol-5-yl)-2-bromopentan-1-one (PubChem CID 71313695) has the molecular formula C12H13BrO3 and a molecular weight of 285.14 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-bromopentan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-bromopentan-1-one |
|---|---|
| PubChem CID | 71313695 |
| Molecular Formula | C12H13BrO3 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-bromopentan-1-one |
| SMILES | CCCC(Br)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13BrO3/c1-2-3-9(13)12(14)8-4-5-10-11(6-8)16-7-15-10/h4-6,9H,2-3,7H2,1H3 |
| InChIKey | FQBSUOHBUXPEHI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|