C14H21NO3 — CID 117065179
1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one;methane (PubChem CID 117065179) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one;methane.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one;methane |
|---|---|
| PubChem CID | 117065179 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one;methane |
| SMILES | C.CCCC(NC)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17NO3.CH4/c1-3-4-10(14-2)13(15)9-5-6-11-12(7-9)17-8-16-11;/h5-7,10,14H,3-4,8H2,1-2H3;1H4 |
| InChIKey | OKJVFUGOOWHRBJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |