C25H41NO3 — CID 117065155
1-(1,3-benzodioxol-5-yl)-2-(2,2,3,3,4,4,5,5-octamethylpyrrolidin-1-yl)pentan-1-one;methane (PubChem CID 117065155) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2,2,3,3,4,4,5,5-octamethylpyrrolidin-1-yl)pentan-1-one;methane.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2,2,3,3,4,4,5,5-octamethylpyrrolidin-1-yl)pentan-1-one;methane |
|---|---|
| PubChem CID | 117065155 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2,2,3,3,4,4,5,5-octamethylpyrrolidin-1-yl)pentan-1-one;methane |
| SMILES | C.CCCC(C(=O)c1ccc2c(c1)OCO2)N1C(C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C24H37NO3.CH4/c1-10-11-17(20(26)16-12-13-18-19(14-16)28-15-27-18)25-23(6,7)21(2,3)22(4,5)24(25,8)9;/h12-14,17H,10-11,15H2,1-9H3;1H4 |
| InChIKey | WXPQKXDTLMQJTJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |