C17H17NO3 — CID 788859
N-benzyl-N-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 788859) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-benzyl-N-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-benzyl-N-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 788859 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-benzyl-N-methyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H17NO3/c1-18(12-13-5-3-2-4-6-13)17(19)14-7-8-15-16(11-14)21-10-9-20-15/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | LBYHOTOASGUSHO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |