C19H21NO3 — CID 134028436
N-benzyl-N-propyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 134028436) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is N-benzyl-N-propyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-benzyl-N-propyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 134028436 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-benzyl-N-propyl-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | CCCN(Cc1ccccc1)C(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H21NO3/c1-2-10-20(14-15-6-4-3-5-7-15)19(21)16-8-9-17-18(13-16)23-12-11-22-17/h3-9,13H,2,10-12,14H2,1H3 |
| InChIKey | NJZMOKKDYPFRKY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |