C26H25NO4 — CID 55334437
N,N-dibenzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanamide (PubChem CID 55334437) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is N,N-dibenzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanamide.
| Compound Name | N,N-dibenzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 55334437 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | N,N-dibenzyl-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N(Cc1ccccc1)Cc1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C26H25NO4/c28-23(22-11-13-24-25(17-22)31-16-15-30-24)12-14-26(29)27(18-20-7-3-1-4-8-20)19-21-9-5-2-6-10-21/h1-11,13,17H,12,14-16,18-19H2 |
| InChIKey | FGKBFABDDRZURG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |