C29H25NO4 — CID 42709511
N-benzhydryl-N-[(4-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 42709511) has the molecular formula C29H25NO4 and a molecular weight of 451.52 g/mol. Its IUPAC name is N-benzhydryl-N-[(4-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-benzhydryl-N-[(4-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42709511 |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-benzhydryl-N-[(4-methoxyphenyl)methyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COc1ccc(CN(C(=O)c2ccc3c(c2)OCO3)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H25NO4/c1-32-25-15-12-21(13-16-25)19-30(29(31)24-14-17-26-27(18-24)34-20-33-26)28(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-18,28H,19-20H2,1H3 |
| InChIKey | VYTGXVMQEJHPKY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |