C14H19FN2O2 — CID 55226773
(E)-3-[4-[2-(dimethylamino)ethyl-methylamino]-3-fluorophenyl]prop-2-enoic acid (PubChem CID 55226773) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is (E)-3-[4-[2-(dimethylamino)ethyl-methylamino]-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(dimethylamino)ethyl-methylamino]-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 55226773 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (E)-3-[4-[2-(dimethylamino)ethyl-methylamino]-3-fluorophenyl]prop-2-enoic acid |
| SMILES | CN(C)CCN(C)c1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C14H19FN2O2/c1-16(2)8-9-17(3)13-6-4-11(10-12(13)15)5-7-14(18)19/h4-7,10H,8-9H2,1-3H3,(H,18,19)/b7-5+ |
| InChIKey | UQLFRARREBSRQT-FNORWQNLSA-N |
| XLogP | 1.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|