C14H16FNO2 — CID 114265161
(E)-3-[4-[but-3-enyl(methyl)amino]-3-fluorophenyl]prop-2-enoic acid (PubChem CID 114265161) has the molecular formula C14H16FNO2 and a molecular weight of 249.29 g/mol. Its IUPAC name is (E)-3-[4-[but-3-enyl(methyl)amino]-3-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[but-3-enyl(methyl)amino]-3-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114265161 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (E)-3-[4-[but-3-enyl(methyl)amino]-3-fluorophenyl]prop-2-enoic acid |
| SMILES | C=CCCN(C)c1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C14H16FNO2/c1-3-4-9-16(2)13-7-5-11(10-12(13)15)6-8-14(17)18/h3,5-8,10H,1,4,9H2,2H3,(H,17,18)/b8-6+ |
| InChIKey | KHOUZHRAHPQRCL-SOFGYWHQSA-N |
| XLogP | 2.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|