C14H18FNO2S — CID 112663960
(E)-3-[3-fluoro-4-[[methyl(2-methylsulfanylethyl)amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 112663960) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-[[methyl(2-methylsulfanylethyl)amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-[[methyl(2-methylsulfanylethyl)amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 112663960 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (E)-3-[3-fluoro-4-[[methyl(2-methylsulfanylethyl)amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | CSCCN(C)Cc1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C14H18FNO2S/c1-16(7-8-19-2)10-12-5-3-11(9-13(12)15)4-6-14(17)18/h3-6,9H,7-8,10H2,1-2H3,(H,17,18)/b6-4+ |
| InChIKey | WVGDKJCZUHLDNM-GQCTYLIASA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|