C13H16FNO4S2 — CID 116529913
(E)-3-[3-fluoro-4-(3-methylsulfanylpropylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 116529913) has the molecular formula C13H16FNO4S2 and a molecular weight of 333.41 g/mol. Its IUPAC name is (E)-3-[3-fluoro-4-(3-methylsulfanylpropylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-4-(3-methylsulfanylpropylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 116529913 |
| Molecular Formula | C13H16FNO4S2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | (E)-3-[3-fluoro-4-(3-methylsulfanylpropylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | CSCCCNS(=O)(=O)c1ccc(/C=C/C(=O)O)cc1F |
| InChI | InChI=1S/C13H16FNO4S2/c1-20-8-2-7-15-21(18,19)12-5-3-10(9-11(12)14)4-6-13(16)17/h3-6,9,15H,2,7-8H2,1H3,(H,16,17)/b6-4+ |
| InChIKey | GZGODNSXCPXGQO-GQCTYLIASA-N |
| XLogP | 1.95 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|