C13H21FN2O2S2 — CID 106078152
2-fluoro-4-(methylaminomethyl)-N-(4-methylsulfanylbutyl)benzenesulfonamide (PubChem CID 106078152) has the molecular formula C13H21FN2O2S2 and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-fluoro-4-(methylaminomethyl)-N-(4-methylsulfanylbutyl)benzenesulfonamide.
| Compound Name | 2-fluoro-4-(methylaminomethyl)-N-(4-methylsulfanylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106078152 |
| Molecular Formula | C13H21FN2O2S2 |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-fluoro-4-(methylaminomethyl)-N-(4-methylsulfanylbutyl)benzenesulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCCCSC)c(F)c1 |
| InChI | InChI=1S/C13H21FN2O2S2/c1-15-10-11-5-6-13(12(14)9-11)20(17,18)16-7-3-4-8-19-2/h5-6,9,15-16H,3-4,7-8,10H2,1-2H3 |
| InChIKey | FNUXEOWQUTUBEG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|