C12H17BrFNO2S2 — CID 104922244
4-bromo-2-fluoro-N-(5-methylsulfanylpentyl)benzenesulfonamide (PubChem CID 104922244) has the molecular formula C12H17BrFNO2S2 and a molecular weight of 370.31 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-(5-methylsulfanylpentyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-(5-methylsulfanylpentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 104922244 |
| Molecular Formula | C12H17BrFNO2S2 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 4-bromo-2-fluoro-N-(5-methylsulfanylpentyl)benzenesulfonamide |
| SMILES | CSCCCCCNS(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C12H17BrFNO2S2/c1-18-8-4-2-3-7-15-19(16,17)12-6-5-10(13)9-11(12)14/h5-6,9,15H,2-4,7-8H2,1H3 |
| InChIKey | OKXDPCUHCIYVFJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|