C11H15BrClNO2S2 — CID 113238999
4-bromo-2-chloro-N-(4-methylsulfanylbutyl)benzenesulfonamide (PubChem CID 113238999) has the molecular formula C11H15BrClNO2S2 and a molecular weight of 372.74 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(4-methylsulfanylbutyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(4-methylsulfanylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113238999 |
| Molecular Formula | C11H15BrClNO2S2 |
| Molecular Weight | 372.74 g/mol |
| Exact Mass | 370.94 |
| IUPAC Name | 4-bromo-2-chloro-N-(4-methylsulfanylbutyl)benzenesulfonamide |
| SMILES | CSCCCCNS(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H15BrClNO2S2/c1-17-7-3-2-6-14-18(15,16)11-5-4-9(12)8-10(11)13/h4-5,8,14H,2-3,6-7H2,1H3 |
| InChIKey | HDDHTYYLTQZILP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.74 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|