C11H14BrCl2NS — CID 103087339
4-bromo-2,6-dichloro-N-(4-methylsulfanylbutyl)aniline (PubChem CID 103087339) has the molecular formula C11H14BrCl2NS and a molecular weight of 343.12 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(4-methylsulfanylbutyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(4-methylsulfanylbutyl)aniline |
|---|---|
| PubChem CID | 103087339 |
| Molecular Formula | C11H14BrCl2NS |
| Molecular Weight | 343.12 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(4-methylsulfanylbutyl)aniline |
| SMILES | CSCCCCNc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H14BrCl2NS/c1-16-5-3-2-4-15-11-9(13)6-8(12)7-10(11)14/h6-7,15H,2-5H2,1H3 |
| InChIKey | UAAZFAGQHMKVKJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.12 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|