C10H9BrCl2F3N — CID 113326312
4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutyl)aniline (PubChem CID 113326312) has the molecular formula C10H9BrCl2F3N and a molecular weight of 350.99 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 113326312 |
| Molecular Formula | C10H9BrCl2F3N |
| Molecular Weight | 350.99 g/mol |
| Exact Mass | 348.92 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(4,4,4-trifluorobutyl)aniline |
| SMILES | FC(F)(F)CCCNc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H9BrCl2F3N/c11-6-4-7(12)9(8(13)5-6)17-3-1-2-10(14,15)16/h4-5,17H,1-3H2 |
| InChIKey | CERIRAVRYLEKHL-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.99 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|