C10H10Br2F3N — CID 115513613
2,4-dibromo-N-(4,4,4-trifluorobutyl)aniline (PubChem CID 115513613) has the molecular formula C10H10Br2F3N and a molecular weight of 361.00 g/mol. Its IUPAC name is 2,4-dibromo-N-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 2,4-dibromo-N-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 115513613 |
| Molecular Formula | C10H10Br2F3N |
| Molecular Weight | 361.00 g/mol |
| Exact Mass | 358.91 |
| IUPAC Name | 2,4-dibromo-N-(4,4,4-trifluorobutyl)aniline |
| SMILES | FC(F)(F)CCCNc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H10Br2F3N/c11-7-2-3-9(8(12)6-7)16-5-1-4-10(13,14)15/h2-3,6,16H,1,4-5H2 |
| InChIKey | AMNLTFBZEDRQKS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.00 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|