C11H10BrF6N — CID 115513559
4-bromo-N-(4,4,4-trifluorobutyl)-2-(trifluoromethyl)aniline (PubChem CID 115513559) has the molecular formula C11H10BrF6N and a molecular weight of 350.10 g/mol. Its IUPAC name is 4-bromo-N-(4,4,4-trifluorobutyl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-N-(4,4,4-trifluorobutyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 115513559 |
| Molecular Formula | C11H10BrF6N |
| Molecular Weight | 350.10 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 4-bromo-N-(4,4,4-trifluorobutyl)-2-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)CCCNc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H10BrF6N/c12-7-2-3-9(8(6-7)11(16,17)18)19-5-1-4-10(13,14)15/h2-3,6,19H,1,4-5H2 |
| InChIKey | IIVXKAIJHTVRKC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.10 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|