C12H16BrF3N2 — CID 65483236
N'-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethylpropane-1,3-diamine (PubChem CID 65483236) has the molecular formula C12H16BrF3N2 and a molecular weight of 325.17 g/mol. Its IUPAC name is N'-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 65483236 |
| Molecular Formula | C12H16BrF3N2 |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | N'-[4-bromo-2-(trifluoromethyl)phenyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C12H16BrF3N2/c1-2-17-6-3-7-18-11-5-4-9(13)8-10(11)12(14,15)16/h4-5,8,17-18H,2-3,6-7H2,1H3 |
| InChIKey | CGZIQDHQDLDRNE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|