C13H17BrF3NO2S — CID 106723263
4-bromo-N-(2-tert-butylsulfonylethyl)-2-(trifluoromethyl)aniline (PubChem CID 106723263) has the molecular formula C13H17BrF3NO2S and a molecular weight of 388.25 g/mol. Its IUPAC name is 4-bromo-N-(2-tert-butylsulfonylethyl)-2-(trifluoromethyl)aniline.
| Compound Name | 4-bromo-N-(2-tert-butylsulfonylethyl)-2-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 106723263 |
| Molecular Formula | C13H17BrF3NO2S |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 4-bromo-N-(2-tert-butylsulfonylethyl)-2-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)S(=O)(=O)CCNc1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H17BrF3NO2S/c1-12(2,3)21(19,20)7-6-18-11-5-4-9(14)8-10(11)13(15,16)17/h4-5,8,18H,6-7H2,1-3H3 |
| InChIKey | YRSLRZRBZOQHJL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |