C11H14Br3NS — CID 103087337
2,4,6-tribromo-N-(4-methylsulfanylbutyl)aniline (PubChem CID 103087337) has the molecular formula C11H14Br3NS and a molecular weight of 432.02 g/mol. Its IUPAC name is 2,4,6-tribromo-N-(4-methylsulfanylbutyl)aniline.
| Compound Name | 2,4,6-tribromo-N-(4-methylsulfanylbutyl)aniline |
|---|---|
| PubChem CID | 103087337 |
| Molecular Formula | C11H14Br3NS |
| Molecular Weight | 432.02 g/mol |
| Exact Mass | 428.84 |
| IUPAC Name | 2,4,6-tribromo-N-(4-methylsulfanylbutyl)aniline |
| SMILES | CSCCCCNc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C11H14Br3NS/c1-16-5-3-2-4-15-11-9(13)6-8(12)7-10(11)14/h6-7,15H,2-5H2,1H3 |
| InChIKey | QWUJZQSNUWMVSS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.02 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|