C12H17Br2NS — CID 103087335
2,6-dibromo-4-methyl-N-(4-methylsulfanylbutyl)aniline (PubChem CID 103087335) has the molecular formula C12H17Br2NS and a molecular weight of 367.15 g/mol. Its IUPAC name is 2,6-dibromo-4-methyl-N-(4-methylsulfanylbutyl)aniline.
| Compound Name | 2,6-dibromo-4-methyl-N-(4-methylsulfanylbutyl)aniline |
|---|---|
| PubChem CID | 103087335 |
| Molecular Formula | C12H17Br2NS |
| Molecular Weight | 367.15 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 2,6-dibromo-4-methyl-N-(4-methylsulfanylbutyl)aniline |
| SMILES | CSCCCCNc1c(Br)cc(C)cc1Br |
| InChI | InChI=1S/C12H17Br2NS/c1-9-7-10(13)12(11(14)8-9)15-5-3-4-6-16-2/h7-8,15H,3-6H2,1-2H3 |
| InChIKey | FNZMOLJPWDJLGV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.15 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|