C12H15Br2NO2S — CID 63452023
methyl 3,5-dibromo-2-(3-methylsulfanylpropylamino)benzoate (PubChem CID 63452023) has the molecular formula C12H15Br2NO2S and a molecular weight of 397.13 g/mol. Its IUPAC name is methyl 3,5-dibromo-2-(3-methylsulfanylpropylamino)benzoate.
| Compound Name | methyl 3,5-dibromo-2-(3-methylsulfanylpropylamino)benzoate |
|---|---|
| PubChem CID | 63452023 |
| Molecular Formula | C12H15Br2NO2S |
| Molecular Weight | 397.13 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | methyl 3,5-dibromo-2-(3-methylsulfanylpropylamino)benzoate |
| SMILES | COC(=O)c1cc(Br)cc(Br)c1NCCCSC |
| InChI | InChI=1S/C12H15Br2NO2S/c1-17-12(16)9-6-8(13)7-10(14)11(9)15-4-3-5-18-2/h6-7,15H,3-5H2,1-2H3 |
| InChIKey | HCWUUIIDZRPZBE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.13 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|